CAS 855853-24-6 is the registry number for Fmoc-D-Asp(OPP)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid (CAS 855853-24-6) is a chemical compound with the molecular formula C28H27NO6 and a molecular weight of 473.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid. InChIKey: MEAHCBOPNIDLFH-XMMPIXPASA-N.
| Molecular formula | C28H27NO6 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid |
| InChIKey | MEAHCBOPNIDLFH-XMMPIXPASA-N |
| SMILES | CC(C)(C1=CC=CC=C1)OC(=O)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)