CAS 200336-86-3 appears in our catalog under these names: Fmoc-asp(2-phenylisopropyl ester)-oh, 95%, Fmoc–Asp(2–phenylisopropyl ester)–OH, Fmoc-L-Asp(OPP)-OH, Fmoc-L-aspartic acid beta-2-phenylisopropyl ester, Fmoc-Asp(O-2-PhiPr)-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 250mg, 5g, 1g, 25g, 500mg, 1000mg, 5000mg, 2000mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid (CAS 200336-86-3) is a chemical compound with the molecular formula C28H27NO6 and a molecular weight of 473.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid. InChIKey: MEAHCBOPNIDLFH-DEOSSOPVSA-N.
| Molecular formula | C28H27NO6 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2-phenylpropan-2-yloxy)butanoic acid |
| InChIKey | MEAHCBOPNIDLFH-DEOSSOPVSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)