Products 1234616-06-8
CAS 1234616-06-8 appears in our catalog under these names: 8-Bromoimidazo[1,2-a]pyridine-6-carboxylic acid, 97%, 8-Bromoimidazo(1,2-a)pyridine-6-carboxylic acid, 98%, 8-Bromoimidazo(1,2-a)pyridine-6-carboxylic acid, 8-Bromoimidazo[1,2-a]pyridine-6-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g, 10mg, 50mg, 100mg.
8-bromoimidazo[1,2-a]pyridine-6-carboxylic acid (CAS 1234616-06-8) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 8-bromoimidazo[1,2-a]pyridine-6-carboxylic acid. InChIKey: VVZFQMHWQNIOKK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 8-bromoimidazo[1,2-a]pyridine-6-carboxylic acid |
| InChIKey | VVZFQMHWQNIOKK-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Br)C(=O)O |
Computed by PubChem (NCBI)