CAS 1235439-79-8 appears in our catalog under these names: 2-(Piperazin-1-yl)-1h-1,3-benzodiazole dihydrochloride, 95%, 2-(Piperazin-1-yl)-1H-1,3-benzodiazole dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2-piperazin-1-yl-1H-benzimidazole;dihydrochloride (CAS 1235439-79-8) is a chemical compound with the molecular formula C11H16Cl2N4 and a molecular weight of 275.17 g/mol. IUPAC name: 2-piperazin-1-yl-1H-benzimidazole;dihydrochloride. InChIKey: VQPFOTRGYMKZPR-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N4 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 2-piperazin-1-yl-1H-benzimidazole;dihydrochloride |
| InChIKey | VQPFOTRGYMKZPR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3N2.Cl.Cl |
Computed by PubChem (NCBI)