CAS 853680-34-9 is the registry number for 1-{Imidazo(1,2-a)pyridin-3-yl}piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-piperazin-1-ylimidazo[1,2-a]pyridine;dihydrochloride (CAS 853680-34-9) is a chemical compound with the molecular formula C11H16Cl2N4 and a molecular weight of 275.17 g/mol. IUPAC name: 3-piperazin-1-ylimidazo[1,2-a]pyridine;dihydrochloride. InChIKey: LVVMAMUGLHOGLN-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N4 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 3-piperazin-1-ylimidazo[1,2-a]pyridine;dihydrochloride |
| InChIKey | LVVMAMUGLHOGLN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=C3N2C=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)