Products 2361645-68-1

CAS 2361645-68-1 is the registry number for 2-(1,4-Diazepan-1-yl)pyridine-3-carbonitrile dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(1,4-diazepan-1-yl)pyridine-3-carbonitrile;dihydrochloride (CAS 2361645-68-1) is a chemical compound with the molecular formula C11H16Cl2N4 and a molecular weight of 275.17 g/mol. IUPAC name: 2-(1,4-diazepan-1-yl)pyridine-3-carbonitrile;dihydrochloride. InChIKey: ONMUZWSPIDEFDU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16Cl2N4
Molecular weight275.17 g/mol
IUPAC name2-(1,4-diazepan-1-yl)pyridine-3-carbonitrile;dihydrochloride
InChIKeyONMUZWSPIDEFDU-UHFFFAOYSA-N
SMILESC1CNCCN(C1)C2=C(C=CC=N2)C#N.Cl.Cl

Computed by PubChem (NCBI)