CAS 1427378-77-5 appears in our catalog under these names: 2-(1-Methyl-3-phenyl-1H-1,2,4-triazol-5-yl)ethan-1-amine dihydrochloride, 95%, 2-(1-Methyl-3-phenyl-1H-1,2,4-triazol-5-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (CAS 1427378-77-5) is a chemical compound with the molecular formula C11H16Cl2N4 and a molecular weight of 275.17 g/mol. IUPAC name: 2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride. InChIKey: JJLAZAAKEQGJHK-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N4 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| InChIKey | JJLAZAAKEQGJHK-UHFFFAOYSA-N |
| SMILES | CN1C(=NC(=N1)C2=CC=CC=C2)CCN.Cl.Cl |
Computed by PubChem (NCBI)