CAS 1235441-48-1 appears in our catalog under these names: N-[4-(2-Chloropropanamido)phenyl]thiophene-2-carboxamide, 95%, N-(4-(2-Chloropropanamido)phenyl)thiophene-2-carboxamide, 95%, N-(4-(2-Chloropropanamido)phenyl)thiophene-2-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
N-[4-(2-chloropropanoylamino)phenyl]thiophene-2-carboxamide (CAS 1235441-48-1) is a chemical compound with the molecular formula C14H13ClN2O2S and a molecular weight of 308.8 g/mol. IUPAC name: N-[4-(2-chloropropanoylamino)phenyl]thiophene-2-carboxamide. InChIKey: FQQWGHGXXLNTOG-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2S |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | N-[4-(2-chloropropanoylamino)phenyl]thiophene-2-carboxamide |
| InChIKey | FQQWGHGXXLNTOG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)NC(=O)C2=CC=CS2)Cl |
Computed by PubChem (NCBI)