CAS 1607265-60-0 is the registry number for 2-(2-Chloropropanamido)-5-phenylthiophene-3-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-chloropropanoylamino)-5-phenylthiophene-3-carboxamide (CAS 1607265-60-0) is a chemical compound with the molecular formula C14H13ClN2O2S and a molecular weight of 308.8 g/mol. IUPAC name: 2-(2-chloropropanoylamino)-5-phenylthiophene-3-carboxamide. InChIKey: KLGANGXKPWDSKS-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2S |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 2-(2-chloropropanoylamino)-5-phenylthiophene-3-carboxamide |
| InChIKey | KLGANGXKPWDSKS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(S1)C2=CC=CC=C2)C(=O)N)Cl |
Computed by PubChem (NCBI)