CAS 1797170-85-4 appears in our catalog under these names: 2-Methyl-1-(thiophen-3-ylmethyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%, 2-Methyl-1-(thiophen-3-ylmethyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid;hydrochloride (CAS 1797170-85-4) is a chemical compound with the molecular formula C14H13ClN2O2S and a molecular weight of 308.8 g/mol. IUPAC name: 2-methyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: FZHPDJSXAYUABI-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2S |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 2-methyl-1-(thiophen-3-ylmethyl)benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | FZHPDJSXAYUABI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1CC3=CSC=C3)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)