CAS 1803561-26-3 is the registry number for 2-(2-(2-Methyl-1,3-thiazol-4-yl)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride (CAS 1803561-26-3) is a chemical compound with the molecular formula C14H13ClN2O2S and a molecular weight of 308.8 g/mol. IUPAC name: 2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride. InChIKey: PSSGLZWNUFELLP-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2S |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione;hydrochloride |
| InChIKey | PSSGLZWNUFELLP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)CCN2C(=O)C3=CC=CC=C3C2=O.Cl |
Computed by PubChem (NCBI)