Products 1235566-58-1
CAS 1235566-58-1 is the registry number for 3-Isopropoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1235566-58-1) is a chemical compound with the molecular formula C15H23BO4 and a molecular weight of 278.15 g/mol. IUPAC name: 3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: MHPMIVZMCDBNSE-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 3-propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | MHPMIVZMCDBNSE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(C)C)O |
Computed by PubChem (NCBI)