Products 123574-90-3
CAS 123574-90-3 is the registry number for methyl 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoate (CAS 123574-90-3) is a chemical compound with the molecular formula C23H18N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: methyl 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoate. InChIKey: HVQXSGZSESIUTJ-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | methyl 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoate |
| InChIKey | HVQXSGZSESIUTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)