CAS 5102-79-4 appears in our catalog under these names: 1H-Indene-1,3(2H)-dione, 2-(2,2-diphenylacetyl)-, 1-hydrazone, 2-Diphenylacetyl-1,3-indandione-1-hydrazone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one (CAS 5102-79-4) is a chemical compound with the molecular formula C23H18N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one. InChIKey: QBGMRRUHCFHZLC-NJNXFGOHSA-N.
| Molecular formula | C23H18N2O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (3Z)-2-(2,2-diphenylacetyl)-3-hydrazinylideneinden-1-one |
| InChIKey | QBGMRRUHCFHZLC-NJNXFGOHSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3/C(=N/N)/C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)