Products 955964-50-8

CAS 955964-50-8 is the registry number for 1-(3-Methylphenyl)-5-(4-phenylphenyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxylic acid (CAS 955964-50-8) is a chemical compound with the molecular formula C23H18N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: 1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxylic acid. InChIKey: GCKSOGWBQNSOJI-UHFFFAOYSA-N.

Identity
Molecular formulaC23H18N2O2
Molecular weight354.4 g/mol
IUPAC name1-(3-methylphenyl)-5-(4-phenylphenyl)pyrazole-3-carboxylic acid
InChIKeyGCKSOGWBQNSOJI-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)N2C(=CC(=N2)C(=O)O)C3=CC=C(C=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)