CAS 138039-82-4 is the registry number for 2-(diphenylacetyl)-3-hydrazino-1H-Inden-1-one. Offered by: TRC. Available pack sizes: 5g.
1-(1-hydrazinylidene-3-hydroxyinden-2-yl)-2,2-diphenylethanone (CAS 138039-82-4) is a chemical compound with the molecular formula C23H18N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: 1-(1-hydrazinylidene-3-hydroxyinden-2-yl)-2,2-diphenylethanone. InChIKey: HJAINDDRYWUOTK-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 1-(1-hydrazinylidene-3-hydroxyinden-2-yl)-2,2-diphenylethanone |
| InChIKey | HJAINDDRYWUOTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3=C(C4=CC=CC=C4C3=NN)O |
Computed by PubChem (NCBI)