CAS 123599-90-6 is the registry number for 4-(2,4-Difluoro-phenoxy)-phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-difluorophenoxy)phenol (CAS 123599-90-6) is a chemical compound with the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. IUPAC name: 4-(2,4-difluorophenoxy)phenol. InChIKey: JPEJUCMBHWQOMZ-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O2 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 4-(2,4-difluorophenoxy)phenol |
| InChIKey | JPEJUCMBHWQOMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)