Products 73790-14-4

CAS 73790-14-4 appears in our catalog under these names: alpha,alpha-Difluoro-1-naphthaleneacetic acid, 2,2-difluoro-2-(naphthalen-1-yl)acetic acid, ≥95%, ≥95%, 2,2-Difluoro-2-(naphthalen-1-yl)acetic acid, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-naphthalen-1-ylacetic acid (CAS 73790-14-4) is a chemical compound with the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. IUPAC name: 2,2-difluoro-2-naphthalen-1-ylacetic acid. InChIKey: TXILYIHFGBMXDH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8F2O2
Molecular weight222.19 g/mol
IUPAC name2,2-difluoro-2-naphthalen-1-ylacetic acid
InChIKeyTXILYIHFGBMXDH-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2C(C(=O)O)(F)F

Computed by PubChem (NCBI)