CAS 73790-14-4 appears in our catalog under these names: alpha,alpha-Difluoro-1-naphthaleneacetic acid, 2,2-difluoro-2-(naphthalen-1-yl)acetic acid, ≥95%, ≥95%, 2,2-Difluoro-2-(naphthalen-1-yl)acetic acid, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,2-difluoro-2-naphthalen-1-ylacetic acid (CAS 73790-14-4) is a chemical compound with the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. IUPAC name: 2,2-difluoro-2-naphthalen-1-ylacetic acid. InChIKey: TXILYIHFGBMXDH-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O2 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 2,2-difluoro-2-naphthalen-1-ylacetic acid |
| InChIKey | TXILYIHFGBMXDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(=O)O)(F)F |
Computed by PubChem (NCBI)