CAS 1261488-79-2 appears in our catalog under these names: 6-(Difluoromethoxy)-2-naphthaldehyde, 2-(Difluoromethoxy)naphthalene-6-carboxaldehyde, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-(difluoromethoxy)naphthalene-2-carbaldehyde (CAS 1261488-79-2) is a chemical compound with the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. IUPAC name: 6-(difluoromethoxy)naphthalene-2-carbaldehyde. InChIKey: MYFVKWOYSOETDL-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O2 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 6-(difluoromethoxy)naphthalene-2-carbaldehyde |
| InChIKey | MYFVKWOYSOETDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)OC(F)F)C=C1C=O |
Computed by PubChem (NCBI)