CAS 2891439-19-1 is the registry number for 2,2'-Difluoro-[1,1'-biphenyl]-3,3'-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-3-(2-fluoro-3-hydroxyphenyl)phenol (CAS 2891439-19-1) is a chemical compound with the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. IUPAC name: 2-fluoro-3-(2-fluoro-3-hydroxyphenyl)phenol. InChIKey: CPMOBCKAZHLAFG-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O2 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 2-fluoro-3-(2-fluoro-3-hydroxyphenyl)phenol |
| InChIKey | CPMOBCKAZHLAFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)F)C2=C(C(=CC=C2)O)F |
Computed by PubChem (NCBI)