CAS 1236262-07-9 is the registry number for 2-Amino-1-(2,3-dihydro-1H-indol-1-yl)-1-propanone hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one;hydrochloride (CAS 1236262-07-9) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one;hydrochloride. InChIKey: RMRGKSSRCKOMRL-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 2-amino-1-(2,3-dihydroindol-1-yl)propan-1-one;hydrochloride |
| InChIKey | RMRGKSSRCKOMRL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)