Products 1236764-04-7
CAS 1236764-04-7 is the registry number for ethyl 3-amino-4-cyclopropyl-1H-pyrrole-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 3-amino-4-cyclopropyl-1H-pyrrole-2-carboxylate (CAS 1236764-04-7) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: ethyl 3-amino-4-cyclopropyl-1H-pyrrole-2-carboxylate. InChIKey: IGBRODSRLSQDSX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | ethyl 3-amino-4-cyclopropyl-1H-pyrrole-2-carboxylate |
| InChIKey | IGBRODSRLSQDSX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CN1)C2CC2)N |
Computed by PubChem (NCBI)