CAS 1349718-44-0 appears in our catalog under these names: 3-[4-(Trifluoromethyl)phenyl]oxetan-3-amine hydrochloride, 95%, 3-(4-(Trifluoromethyl)phenyl)oxetan-3-amine hydrochloride, 97%, 3-[4-(Trifluoromethyl)phenyl]oxetan-3-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
3-[4-(trifluoromethyl)phenyl]oxetan-3-amine;hydrochloride (CAS 1349718-44-0) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]oxetan-3-amine;hydrochloride. InChIKey: LREFYQKSBQNBAE-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]oxetan-3-amine;hydrochloride |
| InChIKey | LREFYQKSBQNBAE-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)