CAS 1237745-83-3 is the registry number for 4,8–Dichloro–2–(4–cyclopropyl–1,3–thiazol–2–yl)–7–methoxyquinoline. Offered by: GLPBio. Available pack sizes: 100mg.
4-cyclopropyl-2-(4,8-dichloro-7-methoxyquinolin-2-yl)-1,3-thiazole (CAS 1237745-83-3) is a chemical compound with the molecular formula C16H12Cl2N2OS and a molecular weight of 351.2 g/mol. IUPAC name: 4-cyclopropyl-2-(4,8-dichloro-7-methoxyquinolin-2-yl)-1,3-thiazole. InChIKey: BYVQXTYOISYCKD-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2OS |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 4-cyclopropyl-2-(4,8-dichloro-7-methoxyquinolin-2-yl)-1,3-thiazole |
| InChIKey | BYVQXTYOISYCKD-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=CC(=N2)C3=NC(=CS3)C4CC4)Cl)Cl |
Computed by PubChem (NCBI)