CAS 565178-11-2 appears in our catalog under these names: [4-(2,4-Dichloro-phenyl)-thiazol-2-yl]-(3-methoxy-phenyl)-amine, 95%, 4-(2,4-Dichlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(2,4-dichlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine (CAS 565178-11-2) is a chemical compound with the molecular formula C16H12Cl2N2OS and a molecular weight of 351.2 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine. InChIKey: PBHOZDBOSVKLDH-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2OS |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | PBHOZDBOSVKLDH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC2=NC(=CS2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)