Products 862825-90-9
CAS 862825-90-9 is the registry number for RSV-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3,4-dichlorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide (CAS 862825-90-9) is a chemical compound with the molecular formula C16H12Cl2N2OS and a molecular weight of 351.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide. InChIKey: OUNROJVGCGSCFI-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2OS |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-2-(1H-indol-3-ylsulfanyl)acetamide |
| InChIKey | OUNROJVGCGSCFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)SCC(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)