CAS 793678-89-4 is the registry number for 3-(2-(2,4-Dichlorophenyl)ethyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one (CAS 793678-89-4) is a chemical compound with the molecular formula C16H12Cl2N2OS and a molecular weight of 351.2 g/mol. IUPAC name: 3-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: KNJLKTJZUJZPEG-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2OS |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 3-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | KNJLKTJZUJZPEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=S)N2)CCC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)