CAS 123882-32-6 is the registry number for (R)-2-(2-Oxo-4-phenyloxazolidin-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetic acid (CAS 123882-32-6) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetic acid. InChIKey: PUKMRNJLFMISMT-VIFPVBQESA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetic acid |
| InChIKey | PUKMRNJLFMISMT-VIFPVBQESA-N |
| SMILES | C1[C@H](N(C(=O)O1)CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)