Products 1239160-81-6
CAS 1239160-81-6 is the registry number for 3-Methyl-4-(4-methylphenyl)-1H-pyrazol-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-methyl-4-(4-methylphenyl)-1H-pyrazol-3-amine;hydrochloride (CAS 1239160-81-6) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: 5-methyl-4-(4-methylphenyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: BXADVNCZRAEKBL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 5-methyl-4-(4-methylphenyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | BXADVNCZRAEKBL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(NN=C2N)C.Cl |
Computed by PubChem (NCBI)