CAS 1239600-44-2 is the registry number for (2R,2'R)-2,2'-Biindoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(2R)-2,3-dihydro-1H-indol-2-yl]-2,3-dihydro-1H-indole (CAS 1239600-44-2) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: (2R)-2-[(2R)-2,3-dihydro-1H-indol-2-yl]-2,3-dihydro-1H-indole. InChIKey: VTRXPGMEDRKZSJ-HZPDHXFCSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | (2R)-2-[(2R)-2,3-dihydro-1H-indol-2-yl]-2,3-dihydro-1H-indole |
| InChIKey | VTRXPGMEDRKZSJ-HZPDHXFCSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)[C@H]3CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)