Products 1240527-28-9

CAS 1240527-28-9 is the registry number for 4-(Thiomorpholin-4-ylmethyl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

4-(thiomorpholin-4-ylmethyl)benzoic acid;hydrochloride (CAS 1240527-28-9) is a chemical compound with the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. IUPAC name: 4-(thiomorpholin-4-ylmethyl)benzoic acid;hydrochloride. InChIKey: HIOVCLSMVPAOMB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO2S
Molecular weight273.78 g/mol
IUPAC name4-(thiomorpholin-4-ylmethyl)benzoic acid;hydrochloride
InChIKeyHIOVCLSMVPAOMB-UHFFFAOYSA-N
SMILESC1CSCCN1CC2=CC=C(C=C2)C(=O)O.Cl

Computed by PubChem (NCBI)