CAS 852388-74-0 appears in our catalog under these names: N-{(5-(2-chloroacetyl)thiophen-2-yl)methyl}-2,2-dimethylpropanamide, 95%, N-{(5-(2-Chloroacetyl)thiophen-2-yl)methyl}-2,2-dimethylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-[[5-(2-chloroacetyl)thiophen-2-yl]methyl]-2,2-dimethylpropanamide (CAS 852388-74-0) is a chemical compound with the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. IUPAC name: N-[[5-(2-chloroacetyl)thiophen-2-yl]methyl]-2,2-dimethylpropanamide. InChIKey: YNZOBMUDBJQAJA-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2S |
|---|---|
| Molecular weight | 273.78 g/mol |
| IUPAC name | N-[[5-(2-chloroacetyl)thiophen-2-yl]methyl]-2,2-dimethylpropanamide |
| InChIKey | YNZOBMUDBJQAJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCC1=CC=C(S1)C(=O)CCl |
Computed by PubChem (NCBI)