CAS 1706441-36-2 is the registry number for 4-(2-Methanesulfonylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 1706441-36-2) is a chemical compound with the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. IUPAC name: 4-(2-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: GFBWAMHPFFLVER-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2S |
|---|---|
| Molecular weight | 273.78 g/mol |
| IUPAC name | 4-(2-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | GFBWAMHPFFLVER-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1C2=CCNCC2.Cl |
Computed by PubChem (NCBI)