CAS 2243505-01-1 is the registry number for 3a-Phenyl-hexahydro-1H-2λ6-thieno(3,4-c)pyrrole-2,2-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3a-phenyl-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide;hydrochloride (CAS 2243505-01-1) is a chemical compound with the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. IUPAC name: 3a-phenyl-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide;hydrochloride. InChIKey: FOASJTIRPXEZPQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2S |
|---|---|
| Molecular weight | 273.78 g/mol |
| IUPAC name | 3a-phenyl-1,3,4,5,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide;hydrochloride |
| InChIKey | FOASJTIRPXEZPQ-UHFFFAOYSA-N |
| SMILES | C1C2CS(=O)(=O)CC2(CN1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)