CAS 1240527-52-9 appears in our catalog under these names: 3-(1H-Pyrazol-4-yl)phenol, 95%, 3-(1H-Pyrazol-4-yl)phenol. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-(1H-pyrazol-4-yl)phenol (CAS 1240527-52-9) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 3-(1H-pyrazol-4-yl)phenol. InChIKey: PSYYOXSEZAFDHF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 3-(1H-pyrazol-4-yl)phenol |
| InChIKey | PSYYOXSEZAFDHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CNN=C2 |
Computed by PubChem (NCBI)