CAS 1240528-04-4 is the registry number for 5–((Methylsulfonyl)methyl)tetrahydrofuran–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 10g, 1g, 250mg, 500mg, 5g.
5-(methylsulfonylmethyl)oxolane-2-carboxylic acid (CAS 1240528-04-4) is a chemical compound with the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. IUPAC name: 5-(methylsulfonylmethyl)oxolane-2-carboxylic acid. InChIKey: PDPDZOOAVRIGCC-UHFFFAOYSA-N.
| Molecular formula | C7H12O5S |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 5-(methylsulfonylmethyl)oxolane-2-carboxylic acid |
| InChIKey | PDPDZOOAVRIGCC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1CCC(O1)C(=O)O |
Computed by PubChem (NCBI)