Products 1240528-04-4

CAS 1240528-04-4 is the registry number for 5–((Methylsulfonyl)methyl)tetrahydrofuran–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 10g, 1g, 250mg, 500mg, 5g.

Structural formula: {0} (CAS {1})

5-(methylsulfonylmethyl)oxolane-2-carboxylic acid (CAS 1240528-04-4) is a chemical compound with the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. IUPAC name: 5-(methylsulfonylmethyl)oxolane-2-carboxylic acid. InChIKey: PDPDZOOAVRIGCC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O5S
Molecular weight208.23 g/mol
IUPAC name5-(methylsulfonylmethyl)oxolane-2-carboxylic acid
InChIKeyPDPDZOOAVRIGCC-UHFFFAOYSA-N
SMILESCS(=O)(=O)CC1CCC(O1)C(=O)O

Computed by PubChem (NCBI)