CAS 1248276-51-8 is the registry number for 4-Methoxytetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-methoxy-1,1-dioxothiane-4-carboxylic acid (CAS 1248276-51-8) is a chemical compound with the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. IUPAC name: 4-methoxy-1,1-dioxothiane-4-carboxylic acid. InChIKey: VZWXCLFIEYSJEL-UHFFFAOYSA-N.
| Molecular formula | C7H12O5S |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 4-methoxy-1,1-dioxothiane-4-carboxylic acid |
| InChIKey | VZWXCLFIEYSJEL-UHFFFAOYSA-N |
| SMILES | COC1(CCS(=O)(=O)CC1)C(=O)O |
Computed by PubChem (NCBI)