CAS 61053-62-1 is the registry number for Ethyl 2-(methylsulfonyl)-3-oxobutanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-methylsulfonyl-3-oxobutanoate (CAS 61053-62-1) is a chemical compound with the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. IUPAC name: ethyl 2-methylsulfonyl-3-oxobutanoate. InChIKey: GTNYGPRTTIXNGU-UHFFFAOYSA-N.
| Molecular formula | C7H12O5S |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | ethyl 2-methylsulfonyl-3-oxobutanoate |
| InChIKey | GTNYGPRTTIXNGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)S(=O)(=O)C |
Computed by PubChem (NCBI)