CAS 1429422-08-1 is the registry number for Rel-methyl (1s,3s)-3-((methylsulfonyl)oxy)cyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-methylsulfonyloxycyclobutane-1-carboxylate (CAS 1429422-08-1) is a chemical compound with the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. IUPAC name: methyl 3-methylsulfonyloxycyclobutane-1-carboxylate. InChIKey: MURFFISQSWZKCL-UHFFFAOYSA-N.
| Molecular formula | C7H12O5S |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | methyl 3-methylsulfonyloxycyclobutane-1-carboxylate |
| InChIKey | MURFFISQSWZKCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)