CAS 1240529-53-6 appears in our catalog under these names: 2-[5-Methyl-2-(thiophen-3-yl)-1,3-oxazol-4-yl]acetic acid, 95%, 2-(5-Methyl-2-(thiophen-3-yl)-1,3-oxazol-4-yl)acetic acid, 95%, 2-(5-Methyl-2-(thiophen-3-yl)-1,3-oxazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(5-methyl-2-thiophen-3-yl-1,3-oxazol-4-yl)acetic acid (CAS 1240529-53-6) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-(5-methyl-2-thiophen-3-yl-1,3-oxazol-4-yl)acetic acid. InChIKey: ZPWGLCHQTGQZEO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-(5-methyl-2-thiophen-3-yl-1,3-oxazol-4-yl)acetic acid |
| InChIKey | ZPWGLCHQTGQZEO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CSC=C2)CC(=O)O |
Computed by PubChem (NCBI)