CAS 1240590-33-3 is the registry number for (R)-6-Oxopiperazine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R)-6-oxopiperazine-2-carboxylic acid (CAS 1240590-33-3) is a chemical compound with the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. IUPAC name: (2R)-6-oxopiperazine-2-carboxylic acid. InChIKey: YFTIUIRRLXUUIK-GSVOUGTGSA-N.
| Molecular formula | C5H8N2O3 |
|---|---|
| Molecular weight | 144.13 g/mol |
| IUPAC name | (2R)-6-oxopiperazine-2-carboxylic acid |
| InChIKey | YFTIUIRRLXUUIK-GSVOUGTGSA-N |
| SMILES | C1[C@@H](NC(=O)CN1)C(=O)O |
Computed by PubChem (NCBI)