Products 1240611-09-9

CAS 1240611-09-9 is the registry number for 5-Bromooxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-1,3-oxazole-4-carboxylic acid (CAS 1240611-09-9) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 5-bromo-1,3-oxazole-4-carboxylic acid. InChIKey: IPUQVEWQTATBNH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrNO3
Molecular weight191.97 g/mol
IUPAC name5-bromo-1,3-oxazole-4-carboxylic acid
InChIKeyIPUQVEWQTATBNH-UHFFFAOYSA-N
SMILESC1=NC(=C(O1)Br)C(=O)O

Computed by PubChem (NCBI)