Products 944906-74-5

CAS 944906-74-5 is the registry number for 4-Bromo-oxazole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-1,3-oxazole-2-carboxylic acid (CAS 944906-74-5) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 4-bromo-1,3-oxazole-2-carboxylic acid. InChIKey: RLDKHSPSCDLNRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrNO3
Molecular weight191.97 g/mol
IUPAC name4-bromo-1,3-oxazole-2-carboxylic acid
InChIKeyRLDKHSPSCDLNRZ-UHFFFAOYSA-N
SMILESC1=C(N=C(O1)C(=O)O)Br

Computed by PubChem (NCBI)