CAS 823-73-4 appears in our catalog under these names: 2-Bromo-5-nitrofuran, 95%, 2–Bromo–5–nitrofuran, 2-Bromo-5-nitrofuran, 2-Bromo-5-nitrofuran, >98.0%(GC), 2-Bromo-5-nitrofuran 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 250mg, 5g, 1g, 200mg, 2,5g, 100mg.
2-bromo-5-nitrofuran (CAS 823-73-4) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 2-bromo-5-nitrofuran. InChIKey: QGTDMAKRJHGXOF-UHFFFAOYSA-N.
| Molecular formula | C4H2BrNO3 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 2-bromo-5-nitrofuran |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)