Products 1350551-14-2

CAS 1350551-14-2 is the registry number for 5-Bromoisoxazole-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-1,2-oxazole-3-carboxylic acid (CAS 1350551-14-2) is a chemical compound with the molecular formula C4H2BrNO3 and a molecular weight of 191.97 g/mol. IUPAC name: 5-bromo-1,2-oxazole-3-carboxylic acid. InChIKey: FFYPFKPOBSIPGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrNO3
Molecular weight191.97 g/mol
IUPAC name5-bromo-1,2-oxazole-3-carboxylic acid
InChIKeyFFYPFKPOBSIPGJ-UHFFFAOYSA-N
SMILESC1=C(ON=C1C(=O)O)Br

Computed by PubChem (NCBI)