CAS 1241392-47-1 is the registry number for Benzo(b)thiophene-6-carboxylic acid 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1,1-dioxo-1-benzothiophene-6-carboxylic acid (CAS 1241392-47-1) is a chemical compound with the molecular formula C9H6O4S and a molecular weight of 210.21 g/mol. IUPAC name: 1,1-dioxo-1-benzothiophene-6-carboxylic acid. InChIKey: IIKRQISNUTXLRU-UHFFFAOYSA-N.
| Molecular formula | C9H6O4S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 1,1-dioxo-1-benzothiophene-6-carboxylic acid |
| InChIKey | IIKRQISNUTXLRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)