Products 226259-47-8

CAS 226259-47-8 appears in our catalog under these names: Benzo(b)thiophene-5-carboxylic acid 1,1-dioxide, 95%, Benzo(b)​thiophene-​5-​carboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

1,1-dioxo-1-benzothiophene-5-carboxylic acid (CAS 226259-47-8) is a chemical compound with the molecular formula C9H6O4S and a molecular weight of 210.21 g/mol. IUPAC name: 1,1-dioxo-1-benzothiophene-5-carboxylic acid. InChIKey: KJBAZFOFYZODKB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6O4S
Molecular weight210.21 g/mol
IUPAC name1,1-dioxo-1-benzothiophene-5-carboxylic acid
InChIKeyKJBAZFOFYZODKB-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CS2(=O)=O)C=C1C(=O)O

Computed by PubChem (NCBI)