Products 97852-77-2

CAS 97852-77-2 appears in our catalog under these names: 5,6-Dihydroxy-1-benzothiophene-2-carboxylic acid, 5,6-Dihydroxy-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.

5,6-dihydroxy-1-benzothiophene-2-carboxylic acid (CAS 97852-77-2) is a chemical compound with the molecular formula C9H6O4S and a molecular weight of 210.21 g/mol. IUPAC name: 5,6-dihydroxy-1-benzothiophene-2-carboxylic acid. InChIKey: WXMGXZXENPTLLY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6O4S
Molecular weight210.21 g/mol
IUPAC name5,6-dihydroxy-1-benzothiophene-2-carboxylic acid
InChIKeyWXMGXZXENPTLLY-UHFFFAOYSA-N
SMILESC1=C2C=C(SC2=CC(=C1O)O)C(=O)O

Computed by PubChem (NCBI)