CAS 97852-77-2 appears in our catalog under these names: 5,6-Dihydroxy-1-benzothiophene-2-carboxylic acid, 5,6-Dihydroxy-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5,6-dihydroxy-1-benzothiophene-2-carboxylic acid (CAS 97852-77-2) is a chemical compound with the molecular formula C9H6O4S and a molecular weight of 210.21 g/mol. IUPAC name: 5,6-dihydroxy-1-benzothiophene-2-carboxylic acid. InChIKey: WXMGXZXENPTLLY-UHFFFAOYSA-N.
| Molecular formula | C9H6O4S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 5,6-dihydroxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | WXMGXZXENPTLLY-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(SC2=CC(=C1O)O)C(=O)O |
Computed by PubChem (NCBI)