CAS 4991-69-9 appears in our catalog under these names: 7-Methoxy-2-oxo-2H-1,3-benzoxathiole-5-carbaldehyde, 95%, 7-Methoxy-2-oxo-2H-1,3-benzoxathiole-5-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
7-methoxy-2-oxo-1,3-benzoxathiole-5-carbaldehyde (CAS 4991-69-9) is a chemical compound with the molecular formula C9H6O4S and a molecular weight of 210.21 g/mol. IUPAC name: 7-methoxy-2-oxo-1,3-benzoxathiole-5-carbaldehyde. InChIKey: CHKUOUCLUGYPJO-UHFFFAOYSA-N.
| Molecular formula | C9H6O4S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 7-methoxy-2-oxo-1,3-benzoxathiole-5-carbaldehyde |
| InChIKey | CHKUOUCLUGYPJO-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C=O)SC(=O)O2 |
Computed by PubChem (NCBI)