CAS 1334499-91-0 is the registry number for 1-(2,4-Difluorophenyl)pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-(2,4-difluorophenyl)pyrrolidine (CAS 1334499-91-0) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: 1-(2,4-difluorophenyl)pyrrolidine. InChIKey: HGVQHODWFJESQW-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)pyrrolidine |
| InChIKey | HGVQHODWFJESQW-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)